C15H20ClN3O3 — CID 54178667
4-amino-5-chloro-N-[(3S,4R)-3-methoxypiperidin-4-yl]-2,3-dihydro-1-benzofuran-7-carboxamide (PubChem CID 54178667) has the molecular formula C15H20ClN3O3 and a molecular weight of 325.80 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[(3S,4R)-3-methoxypiperidin-4-yl]-2,3-dihydro-1-benzofuran-7-carboxamide.
| Compound Name | 4-amino-5-chloro-N-[(3S,4R)-3-methoxypiperidin-4-yl]-2,3-dihydro-1-benzofuran-7-carboxamide |
|---|---|
| PubChem CID | 54178667 |
| Molecular Formula | C15H20ClN3O3 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 4-amino-5-chloro-N-[(3S,4R)-3-methoxypiperidin-4-yl]-2,3-dihydro-1-benzofuran-7-carboxamide |
| SMILES | CO[C@H]1CNCC[C@H]1NC(=O)c1cc(Cl)c(N)c2c1OCC2 |
| InChI | InChI=1S/C15H20ClN3O3/c1-21-12-7-18-4-2-11(12)19-15(20)9-6-10(16)13(17)8-3-5-22-14(8)9/h6,11-12,18H,2-5,7,17H2,1H3,(H,19,20)/t11-,12+/m1/s1 |
| InChIKey | PAFSMERYCXZJQT-NEPJUHHUSA-N |
| XLogP | 0.96 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|