C16H22ClN3O3 — CID 15839755
4-amino-5-chloro-N-(3-methoxypiperidin-4-yl)-2-methyl-2,3-dihydro-1-benzofuran-7-carboxamide (PubChem CID 15839755) has the molecular formula C16H22ClN3O3 and a molecular weight of 339.82 g/mol. Its IUPAC name is 4-amino-5-chloro-N-(3-methoxypiperidin-4-yl)-2-methyl-2,3-dihydro-1-benzofuran-7-carboxamide.
| Compound Name | 4-amino-5-chloro-N-(3-methoxypiperidin-4-yl)-2-methyl-2,3-dihydro-1-benzofuran-7-carboxamide |
|---|---|
| PubChem CID | 15839755 |
| Molecular Formula | C16H22ClN3O3 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 4-amino-5-chloro-N-(3-methoxypiperidin-4-yl)-2-methyl-2,3-dihydro-1-benzofuran-7-carboxamide |
| SMILES | COC1CNCCC1NC(=O)c1cc(Cl)c(N)c2c1OC(C)C2 |
| InChI | InChI=1S/C16H22ClN3O3/c1-8-5-9-14(18)11(17)6-10(15(9)23-8)16(21)20-12-3-4-19-7-13(12)22-2/h6,8,12-13,19H,3-5,7,18H2,1-2H3,(H,20,21) |
| InChIKey | ISRADXLYAUKIFL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|