C15H20ClN3O3 — CID 66706362
4-amino-5-chloro-N-[(3-hydroxypiperidin-4-yl)methyl]-2,3-dihydro-1-benzofuran-7-carboxamide (PubChem CID 66706362) has the molecular formula C15H20ClN3O3 and a molecular weight of 325.80 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[(3-hydroxypiperidin-4-yl)methyl]-2,3-dihydro-1-benzofuran-7-carboxamide.
| Compound Name | 4-amino-5-chloro-N-[(3-hydroxypiperidin-4-yl)methyl]-2,3-dihydro-1-benzofuran-7-carboxamide |
|---|---|
| PubChem CID | 66706362 |
| Molecular Formula | C15H20ClN3O3 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 4-amino-5-chloro-N-[(3-hydroxypiperidin-4-yl)methyl]-2,3-dihydro-1-benzofuran-7-carboxamide |
| SMILES | Nc1c(Cl)cc(C(=O)NCC2CCNCC2O)c2c1CCO2 |
| InChI | InChI=1S/C15H20ClN3O3/c16-11-5-10(14-9(13(11)17)2-4-22-14)15(21)19-6-8-1-3-18-7-12(8)20/h5,8,12,18,20H,1-4,6-7,17H2,(H,19,21) |
| InChIKey | TZVUJLKEOUFTLG-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|