C22H28ClN3O6 — CID 122455062
4-amino-5-chloro-N-[[3-(cyclobutylmethyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-2,3-dihydro-1-benzofuran-7-carboxamide;oxalic acid (PubChem CID 122455062) has the molecular formula C22H28ClN3O6 and a molecular weight of 465.93 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[[3-(cyclobutylmethyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-2,3-dihydro-1-benzofuran-7-carboxamide;oxalic acid.
| Compound Name | 4-amino-5-chloro-N-[[3-(cyclobutylmethyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-2,3-dihydro-1-benzofuran-7-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 122455062 |
| Molecular Formula | C22H28ClN3O6 |
| Molecular Weight | 465.93 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 4-amino-5-chloro-N-[[3-(cyclobutylmethyl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-2,3-dihydro-1-benzofuran-7-carboxamide;oxalic acid |
| SMILES | Nc1c(Cl)cc(C(=O)NCC2C3CN(CC4CCC4)CC23)c2c1CCO2.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H26ClN3O2.C2H2O4/c21-17-6-13(19-12(18(17)22)4-5-26-19)20(25)23-7-14-15-9-24(10-16(14)15)8-11-2-1-3-11;3-1(4)2(5)6/h6,11,14-16H,1-5,7-10,22H2,(H,23,25);(H,3,4)(H,5,6) |
| InChIKey | HTWYMICKDAYEFD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.93 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|