C16H23Cl2N3O2 — CID 70065587
4-amino-5-chloro-N-(2-piperidin-1-ylethyl)-2,3-dihydro-1-benzofuran-7-carboxamide;hydrochloride (PubChem CID 70065587) has the molecular formula C16H23Cl2N3O2 and a molecular weight of 360.29 g/mol. Its IUPAC name is 4-amino-5-chloro-N-(2-piperidin-1-ylethyl)-2,3-dihydro-1-benzofuran-7-carboxamide;hydrochloride.
| Compound Name | 4-amino-5-chloro-N-(2-piperidin-1-ylethyl)-2,3-dihydro-1-benzofuran-7-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 70065587 |
| Molecular Formula | C16H23Cl2N3O2 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 4-amino-5-chloro-N-(2-piperidin-1-ylethyl)-2,3-dihydro-1-benzofuran-7-carboxamide;hydrochloride |
| SMILES | Cl.Nc1c(Cl)cc(C(=O)NCCN2CCCCC2)c2c1CCO2 |
| InChI | InChI=1S/C16H22ClN3O2.ClH/c17-13-10-12(15-11(14(13)18)4-9-22-15)16(21)19-5-8-20-6-2-1-3-7-20;/h10H,1-9,18H2,(H,19,21);1H |
| InChIKey | RPUFXDFDDSLEMC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|