C17H25ClN4O2 — CID 19783274
5-amino-N-[1-(2-aminoethyl)piperidin-4-yl]-6-chloro-3,4-dihydro-2H-chromene-8-carboxamide (PubChem CID 19783274) has the molecular formula C17H25ClN4O2 and a molecular weight of 352.87 g/mol. Its IUPAC name is 5-amino-N-[1-(2-aminoethyl)piperidin-4-yl]-6-chloro-3,4-dihydro-2H-chromene-8-carboxamide.
| Compound Name | 5-amino-N-[1-(2-aminoethyl)piperidin-4-yl]-6-chloro-3,4-dihydro-2H-chromene-8-carboxamide |
|---|---|
| PubChem CID | 19783274 |
| Molecular Formula | C17H25ClN4O2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 5-amino-N-[1-(2-aminoethyl)piperidin-4-yl]-6-chloro-3,4-dihydro-2H-chromene-8-carboxamide |
| SMILES | NCCN1CCC(NC(=O)c2cc(Cl)c(N)c3c2OCCC3)CC1 |
| InChI | InChI=1S/C17H25ClN4O2/c18-14-10-13(16-12(15(14)20)2-1-9-24-16)17(23)21-11-3-6-22(7-4-11)8-5-19/h10-11H,1-9,19-20H2,(H,21,23) |
| InChIKey | LUJTWDMLNRBHIV-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|