C19H27ClN4O3S — CID 169358238
4-(carbamothioylamino)-5-chloro-N-[1-(3-methoxypropyl)piperidin-4-yl]-2,3-dihydro-1-benzofuran-7-carboxamide (PubChem CID 169358238) has the molecular formula C19H27ClN4O3S and a molecular weight of 426.97 g/mol. Its IUPAC name is 4-(carbamothioylamino)-5-chloro-N-[1-(3-methoxypropyl)piperidin-4-yl]-2,3-dihydro-1-benzofuran-7-carboxamide.
| Compound Name | 4-(carbamothioylamino)-5-chloro-N-[1-(3-methoxypropyl)piperidin-4-yl]-2,3-dihydro-1-benzofuran-7-carboxamide |
|---|---|
| PubChem CID | 169358238 |
| Molecular Formula | C19H27ClN4O3S |
| Molecular Weight | 426.97 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 4-(carbamothioylamino)-5-chloro-N-[1-(3-methoxypropyl)piperidin-4-yl]-2,3-dihydro-1-benzofuran-7-carboxamide |
| SMILES | COCCCN1CCC(NC(=O)c2cc(Cl)c(NC(N)=S)c3c2OCC3)CC1 |
| InChI | InChI=1S/C19H27ClN4O3S/c1-26-9-2-6-24-7-3-12(4-8-24)22-18(25)14-11-15(20)16(23-19(21)28)13-5-10-27-17(13)14/h11-12H,2-10H2,1H3,(H,22,25)(H3,21,23,28) |
| InChIKey | PSMGFYGCFOSUAU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.97 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|