C26H38ClN7O3 — CID 169376307
5-chloro-4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-N-[1-(3-methoxypropyl)piperidin-4-yl]-2,3-dihydro-1-benzofuran-7-carboxamide (PubChem CID 169376307) has the molecular formula C26H38ClN7O3 and a molecular weight of 532.09 g/mol. Its IUPAC name is 5-chloro-4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-N-[1-(3-methoxypropyl)piperidin-4-yl]-2,3-dihydro-1-benzofuran-7-carboxamide.
| Compound Name | 5-chloro-4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-N-[1-(3-methoxypropyl)piperidin-4-yl]-2,3-dihydro-1-benzofuran-7-carboxamide |
|---|---|
| PubChem CID | 169376307 |
| Molecular Formula | C26H38ClN7O3 |
| Molecular Weight | 532.09 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | 5-chloro-4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-N-[1-(3-methoxypropyl)piperidin-4-yl]-2,3-dihydro-1-benzofuran-7-carboxamide |
| SMILES | COCCCN1CCC(NC(=O)c2cc(Cl)c(N3C(N)=NC(N)=NC34CCCCC4)c3c2OCC3)CC1 |
| InChI | InChI=1S/C26H38ClN7O3/c1-36-14-5-11-33-12-6-17(7-13-33)30-23(35)19-16-20(27)21(18-8-15-37-22(18)19)34-25(29)31-24(28)32-26(34)9-3-2-4-10-26/h16-17H,2-15H2,1H3,(H,30,35)(H4,28,29,31,32) |
| InChIKey | LIBHGVPBFDXJRP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.09 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|