C22H32BrN3O7 — CID 171381207
4-amino-5-bromo-N-[1-(3-methoxypropyl)piperidin-4-yl]-2,3-dihydro-1-benzofuran-7-carboxamide;butanedioic acid (PubChem CID 171381207) has the molecular formula C22H32BrN3O7 and a molecular weight of 530.42 g/mol. Its IUPAC name is 4-amino-5-bromo-N-[1-(3-methoxypropyl)piperidin-4-yl]-2,3-dihydro-1-benzofuran-7-carboxamide;butanedioic acid.
| Compound Name | 4-amino-5-bromo-N-[1-(3-methoxypropyl)piperidin-4-yl]-2,3-dihydro-1-benzofuran-7-carboxamide;butanedioic acid |
|---|---|
| PubChem CID | 171381207 |
| Molecular Formula | C22H32BrN3O7 |
| Molecular Weight | 530.42 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 4-amino-5-bromo-N-[1-(3-methoxypropyl)piperidin-4-yl]-2,3-dihydro-1-benzofuran-7-carboxamide;butanedioic acid |
| SMILES | COCCCN1CCC(NC(=O)c2cc(Br)c(N)c3c2OCC3)CC1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C18H26BrN3O3.C4H6O4/c1-24-9-2-6-22-7-3-12(4-8-22)21-18(23)14-11-15(19)16(20)13-5-10-25-17(13)14;5-3(6)1-2-4(7)8/h11-12H,2-10,20H2,1H3,(H,21,23);1-2H2,(H,5,6)(H,7,8) |
| InChIKey | LFZQRCGVFPFRBA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|