C23H25ClN6O3 — CID 168608767
5-chloro-N-[1-(3-methoxypropyl)piperidin-4-yl]-4-(1,2,2-tricyanoethenylamino)-2,3-dihydro-1-benzofuran-7-carboxamide (PubChem CID 168608767) has the molecular formula C23H25ClN6O3 and a molecular weight of 468.95 g/mol. Its IUPAC name is 5-chloro-N-[1-(3-methoxypropyl)piperidin-4-yl]-4-(1,2,2-tricyanoethenylamino)-2,3-dihydro-1-benzofuran-7-carboxamide.
| Compound Name | 5-chloro-N-[1-(3-methoxypropyl)piperidin-4-yl]-4-(1,2,2-tricyanoethenylamino)-2,3-dihydro-1-benzofuran-7-carboxamide |
|---|---|
| PubChem CID | 168608767 |
| Molecular Formula | C23H25ClN6O3 |
| Molecular Weight | 468.95 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 5-chloro-N-[1-(3-methoxypropyl)piperidin-4-yl]-4-(1,2,2-tricyanoethenylamino)-2,3-dihydro-1-benzofuran-7-carboxamide |
| SMILES | COCCCN1CCC(NC(=O)c2cc(Cl)c(NC(C#N)=C(C#N)C#N)c3c2OCC3)CC1 |
| InChI | InChI=1S/C23H25ClN6O3/c1-32-9-2-6-30-7-3-16(4-8-30)28-23(31)18-11-19(24)21(17-5-10-33-22(17)18)29-20(14-27)15(12-25)13-26/h11,16,29H,2-10H2,1H3,(H,28,31) |
| InChIKey | QIIVVLDLIOIXJX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 134.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.95 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|