C18H26ClN3O3 — CID 162656583
4-amino-5-chloro-N-[1-[3-(trideuteriomethoxy)propyl]piperidin-4-yl]-2,3-dihydro-1-benzofuran-7-carboxamide (PubChem CID 162656583) has the molecular formula C18H26ClN3O3 and a molecular weight of 370.90 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[1-[3-(trideuteriomethoxy)propyl]piperidin-4-yl]-2,3-dihydro-1-benzofuran-7-carboxamide.
| Compound Name | 4-amino-5-chloro-N-[1-[3-(trideuteriomethoxy)propyl]piperidin-4-yl]-2,3-dihydro-1-benzofuran-7-carboxamide |
|---|---|
| PubChem CID | 162656583 |
| Molecular Formula | C18H26ClN3O3 |
| Molecular Weight | 370.90 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 4-amino-5-chloro-N-[1-[3-(trideuteriomethoxy)propyl]piperidin-4-yl]-2,3-dihydro-1-benzofuran-7-carboxamide |
| SMILES | [2H]C([2H])([2H])OCCCN1CCC(NC(=O)c2cc(Cl)c(N)c3c2OCC3)CC1 |
| InChI | InChI=1S/C18H26ClN3O3/c1-24-9-2-6-22-7-3-12(4-8-22)21-18(23)14-11-15(19)16(20)13-5-10-25-17(13)14/h11-12H,2-10,20H2,1H3,(H,21,23)/i1D3 |
| InChIKey | ZPMNHBXQOOVQJL-FIBGUPNXSA-N |
| XLogP | 2.09 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.90 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|