C18H24ClN5O3 — CID 169325707
4-azido-5-chloro-N-[1-(3-methoxypropyl)piperidin-4-yl]-2,3-dihydro-1-benzofuran-7-carboxamide (PubChem CID 169325707) has the molecular formula C18H24ClN5O3 and a molecular weight of 393.88 g/mol. Its IUPAC name is 4-azido-5-chloro-N-[1-(3-methoxypropyl)piperidin-4-yl]-2,3-dihydro-1-benzofuran-7-carboxamide.
| Compound Name | 4-azido-5-chloro-N-[1-(3-methoxypropyl)piperidin-4-yl]-2,3-dihydro-1-benzofuran-7-carboxamide |
|---|---|
| PubChem CID | 169325707 |
| Molecular Formula | C18H24ClN5O3 |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 4-azido-5-chloro-N-[1-(3-methoxypropyl)piperidin-4-yl]-2,3-dihydro-1-benzofuran-7-carboxamide |
| SMILES | COCCCN1CCC(NC(=O)c2cc(Cl)c(N=[N+]=[N-])c3c2OCC3)CC1 |
| InChI | InChI=1S/C18H24ClN5O3/c1-26-9-2-6-24-7-3-12(4-8-24)21-18(25)14-11-15(19)16(22-23-20)13-5-10-27-17(13)14/h11-12H,2-10H2,1H3,(H,21,25) |
| InChIKey | HBHYJDGYKYKMIX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 99.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|