C24H35ClN4O5 — CID 157040581
4-[6-[4-[(4-amino-5-chloro-2,3-dihydro-1-benzofuran-7-carbonyl)amino]piperidin-1-yl]hexanoylamino]butanoic acid (PubChem CID 157040581) has the molecular formula C24H35ClN4O5 and a molecular weight of 495.02 g/mol. Its IUPAC name is 4-[6-[4-[(4-amino-5-chloro-2,3-dihydro-1-benzofuran-7-carbonyl)amino]piperidin-1-yl]hexanoylamino]butanoic acid.
| Compound Name | 4-[6-[4-[(4-amino-5-chloro-2,3-dihydro-1-benzofuran-7-carbonyl)amino]piperidin-1-yl]hexanoylamino]butanoic acid |
|---|---|
| PubChem CID | 157040581 |
| Molecular Formula | C24H35ClN4O5 |
| Molecular Weight | 495.02 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 4-[6-[4-[(4-amino-5-chloro-2,3-dihydro-1-benzofuran-7-carbonyl)amino]piperidin-1-yl]hexanoylamino]butanoic acid |
| SMILES | Nc1c(Cl)cc(C(=O)NC2CCN(CCCCCC(=O)NCCCC(=O)O)CC2)c2c1CCO2 |
| InChI | InChI=1S/C24H35ClN4O5/c25-19-15-18(23-17(22(19)26)9-14-34-23)24(33)28-16-7-12-29(13-8-16)11-3-1-2-5-20(30)27-10-4-6-21(31)32/h15-16H,1-14,26H2,(H,27,30)(H,28,33)(H,31,32) |
| InChIKey | GGSZDQDRPQLVCS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.02 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|