C21H30ClN3O3 — CID 67365957
5-amino-6-chloro-N-[[1-(oxolan-2-ylmethyl)piperidin-4-yl]methyl]-3,4-dihydro-2H-chromene-8-carboxamide (PubChem CID 67365957) has the molecular formula C21H30ClN3O3 and a molecular weight of 407.94 g/mol. Its IUPAC name is 5-amino-6-chloro-N-[[1-(oxolan-2-ylmethyl)piperidin-4-yl]methyl]-3,4-dihydro-2H-chromene-8-carboxamide.
| Compound Name | 5-amino-6-chloro-N-[[1-(oxolan-2-ylmethyl)piperidin-4-yl]methyl]-3,4-dihydro-2H-chromene-8-carboxamide |
|---|---|
| PubChem CID | 67365957 |
| Molecular Formula | C21H30ClN3O3 |
| Molecular Weight | 407.94 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 5-amino-6-chloro-N-[[1-(oxolan-2-ylmethyl)piperidin-4-yl]methyl]-3,4-dihydro-2H-chromene-8-carboxamide |
| SMILES | Nc1c(Cl)cc(C(=O)NCC2CCN(CC3CCCO3)CC2)c2c1CCCO2 |
| InChI | InChI=1S/C21H30ClN3O3/c22-18-11-17(20-16(19(18)23)4-2-10-28-20)21(26)24-12-14-5-7-25(8-6-14)13-15-3-1-9-27-15/h11,14-15H,1-10,12-13,23H2,(H,24,26) |
| InChIKey | QUNVQWJWRQJJOT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.94 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|