C44H66Cl2N6O9 — CID 131718804
bis(4-amino-5-chloro-N-[(3R,4S)-3-methoxy-1-(4-oxopentyl)piperidin-4-yl]-2,2-dimethyl-3H-1-benzofuran-7-carboxamide);hydrate (PubChem CID 131718804) has the molecular formula C44H66Cl2N6O9 and a molecular weight of 893.95 g/mol. Its IUPAC name is bis(4-amino-5-chloro-N-[(3R,4S)-3-methoxy-1-(4-oxopentyl)piperidin-4-yl]-2,2-dimethyl-3H-1-benzofuran-7-carboxamide);hydrate.
| Compound Name | bis(4-amino-5-chloro-N-[(3R,4S)-3-methoxy-1-(4-oxopentyl)piperidin-4-yl]-2,2-dimethyl-3H-1-benzofuran-7-carboxamide);hydrate |
|---|---|
| PubChem CID | 131718804 |
| Molecular Formula | C44H66Cl2N6O9 |
| Molecular Weight | 893.95 g/mol |
| Exact Mass | 892.43 |
| IUPAC Name | bis(4-amino-5-chloro-N-[(3R,4S)-3-methoxy-1-(4-oxopentyl)piperidin-4-yl]-2,2-dimethyl-3H-1-benzofuran-7-carboxamide);hydrate |
| SMILES | CO[C@@H]1CN(CCCC(C)=O)CC[C@@H]1NC(=O)c1cc(Cl)c(N)c2c1OC(C)(C)C2.CO[C@@H]1CN(CCCC(C)=O)CC[C@@H]1NC(=O)c1cc(Cl)c(N)c2c1OC(C)(C)C2.O |
| InChI | InChI=1S/2C22H32ClN3O4.H2O/c2*1-13(27)6-5-8-26-9-7-17(18(12-26)29-4)25-21(28)14-10-16(23)19(24)15-11-22(2,3)30-20(14)15;/h2*10,17-18H,5-9,11-12,24H2,1-4H3,(H,25,28);1H2/t2*17-,18+;/m00./s1 |
| InChIKey | IFJWWNMUJBHLPY-LKKSXLMASA-N |
| XLogP | 4.82 |
| TPSA | 219.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.95 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|