C24H31ClN4O4 — CID 67369244
3-[3-[4-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]piperidin-1-yl]phenyl]propyl carbamate (PubChem CID 67369244) has the molecular formula C24H31ClN4O4 and a molecular weight of 474.99 g/mol. Its IUPAC name is 3-[3-[4-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]piperidin-1-yl]phenyl]propyl carbamate.
| Compound Name | 3-[3-[4-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]piperidin-1-yl]phenyl]propyl carbamate |
|---|---|
| PubChem CID | 67369244 |
| Molecular Formula | C24H31ClN4O4 |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 3-[3-[4-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]piperidin-1-yl]phenyl]propyl carbamate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCC1CCN(c2cccc(CCCOC(N)=O)c2)CC1 |
| InChI | InChI=1S/C24H31ClN4O4/c1-32-22-14-21(26)20(25)13-19(22)23(30)28-15-17-7-9-29(10-8-17)18-6-2-4-16(12-18)5-3-11-33-24(27)31/h2,4,6,12-14,17H,3,5,7-11,15,26H2,1H3,(H2,27,31)(H,28,30) |
| InChIKey | RVBJNZCHAKTRFT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 119.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|