C18H19Cl2N3O2 — CID 119899547
4-amino-5-chloro-N-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methoxybenzamide (PubChem CID 119899547) has the molecular formula C18H19Cl2N3O2 and a molecular weight of 380.28 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methoxybenzamide.
| Compound Name | 4-amino-5-chloro-N-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 119899547 |
| Molecular Formula | C18H19Cl2N3O2 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 4-amino-5-chloro-N-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methoxybenzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NC1CCN(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C18H19Cl2N3O2/c1-25-17-9-16(21)15(20)8-14(17)18(24)22-12-5-6-23(10-12)13-4-2-3-11(19)7-13/h2-4,7-9,12H,5-6,10,21H2,1H3,(H,22,24) |
| InChIKey | SQLXVSCVKUXMRP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|