C24H28ClN5O4 — CID 67368899
[2-[4-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]piperidin-1-yl]-2-(4-cyanophenyl)ethyl] carbamate (PubChem CID 67368899) has the molecular formula C24H28ClN5O4 and a molecular weight of 485.97 g/mol. Its IUPAC name is [2-[4-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]piperidin-1-yl]-2-(4-cyanophenyl)ethyl] carbamate.
| Compound Name | [2-[4-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]piperidin-1-yl]-2-(4-cyanophenyl)ethyl] carbamate |
|---|---|
| PubChem CID | 67368899 |
| Molecular Formula | C24H28ClN5O4 |
| Molecular Weight | 485.97 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | [2-[4-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]piperidin-1-yl]-2-(4-cyanophenyl)ethyl] carbamate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCC1CCN(C(COC(N)=O)c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C24H28ClN5O4/c1-33-22-11-20(27)19(25)10-18(22)23(31)29-13-16-6-8-30(9-7-16)21(14-34-24(28)32)17-4-2-15(12-26)3-5-17/h2-5,10-11,16,21H,6-9,13-14,27H2,1H3,(H2,28,32)(H,29,31) |
| InChIKey | BXSKQPYDHHBTIX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 143.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.97 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|