C27H35ClN4O3 — CID 3044764
N-(1-benzylpiperidin-4-yl)-5-chloro-2-methoxy-4-[(2-piperidin-1-ylacetyl)amino]benzamide (PubChem CID 3044764) has the molecular formula C27H35ClN4O3 and a molecular weight of 499.06 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-5-chloro-2-methoxy-4-[(2-piperidin-1-ylacetyl)amino]benzamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-5-chloro-2-methoxy-4-[(2-piperidin-1-ylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 3044764 |
| Molecular Formula | C27H35ClN4O3 |
| Molecular Weight | 499.06 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-5-chloro-2-methoxy-4-[(2-piperidin-1-ylacetyl)amino]benzamide |
| SMILES | COc1cc(NC(=O)CN2CCCCC2)c(Cl)cc1C(=O)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H35ClN4O3/c1-35-25-17-24(30-26(33)19-31-12-6-3-7-13-31)23(28)16-22(25)27(34)29-21-10-14-32(15-11-21)18-20-8-4-2-5-9-20/h2,4-5,8-9,16-17,21H,3,6-7,10-15,18-19H2,1H3,(H,29,34)(H,30,33) |
| InChIKey | BJDULWCOGWBITL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.06 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |