C24H30ClN3O2 — CID 159265969
5-chloro-4-(methylamino)-N-[1-[(4-methylcyclohexa-1,4-dien-1-yl)methyl]piperidin-4-yl]-2-prop-2-ynoxybenzamide (PubChem CID 159265969) has the molecular formula C24H30ClN3O2 and a molecular weight of 427.98 g/mol. Its IUPAC name is 5-chloro-4-(methylamino)-N-[1-[(4-methylcyclohexa-1,4-dien-1-yl)methyl]piperidin-4-yl]-2-prop-2-ynoxybenzamide.
| Compound Name | 5-chloro-4-(methylamino)-N-[1-[(4-methylcyclohexa-1,4-dien-1-yl)methyl]piperidin-4-yl]-2-prop-2-ynoxybenzamide |
|---|---|
| PubChem CID | 159265969 |
| Molecular Formula | C24H30ClN3O2 |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 5-chloro-4-(methylamino)-N-[1-[(4-methylcyclohexa-1,4-dien-1-yl)methyl]piperidin-4-yl]-2-prop-2-ynoxybenzamide |
| SMILES | C#CCOc1cc(NC)c(Cl)cc1C(=O)NC1CCN(CC2=CCC(C)=CC2)CC1 |
| InChI | InChI=1S/C24H30ClN3O2/c1-4-13-30-23-15-22(26-3)21(25)14-20(23)24(29)27-19-9-11-28(12-10-19)16-18-7-5-17(2)6-8-18/h1,5,8,14-15,19,26H,6-7,9-13,16H2,2-3H3,(H,27,29) |
| InChIKey | KXCJBBIKPHDVNR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|