C22H31N3O4 — CID 67721126
N-[(3S)-1-(9-bicyclo[3.3.1]nonanyl)pyrrolidin-3-yl]-2-methoxy-4-methyl-5-nitrobenzamide (PubChem CID 67721126) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is N-[(3S)-1-(9-bicyclo[3.3.1]nonanyl)pyrrolidin-3-yl]-2-methoxy-4-methyl-5-nitrobenzamide.
| Compound Name | N-[(3S)-1-(9-bicyclo[3.3.1]nonanyl)pyrrolidin-3-yl]-2-methoxy-4-methyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 67721126 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | N-[(3S)-1-(9-bicyclo[3.3.1]nonanyl)pyrrolidin-3-yl]-2-methoxy-4-methyl-5-nitrobenzamide |
| SMILES | COc1cc(C)c([N+](=O)[O-])cc1C(=O)N[C@H]1CCN(C2C3CCCC2CCC3)C1 |
| InChI | InChI=1S/C22H31N3O4/c1-14-11-20(29-2)18(12-19(14)25(27)28)22(26)23-17-9-10-24(13-17)21-15-5-3-6-16(21)8-4-7-15/h11-12,15-17,21H,3-10,13H2,1-2H3,(H,23,26)/t15?,16?,17-,21?/m0/s1 |
| InChIKey | UVLSDTGPMIXSIZ-RVRRWIJOSA-N |
| XLogP | 3.68 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|