C22H33N3O5S — CID 67720688
N-[(3S)-1-(9-bicyclo[3.3.1]nonanyl)pyrrolidin-3-yl]-2,4-dimethoxy-5-sulfamoylbenzamide (PubChem CID 67720688) has the molecular formula C22H33N3O5S and a molecular weight of 451.59 g/mol. Its IUPAC name is N-[(3S)-1-(9-bicyclo[3.3.1]nonanyl)pyrrolidin-3-yl]-2,4-dimethoxy-5-sulfamoylbenzamide.
| Compound Name | N-[(3S)-1-(9-bicyclo[3.3.1]nonanyl)pyrrolidin-3-yl]-2,4-dimethoxy-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 67720688 |
| Molecular Formula | C22H33N3O5S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | N-[(3S)-1-(9-bicyclo[3.3.1]nonanyl)pyrrolidin-3-yl]-2,4-dimethoxy-5-sulfamoylbenzamide |
| SMILES | COc1cc(OC)c(S(N)(=O)=O)cc1C(=O)N[C@H]1CCN(C2C3CCCC2CCC3)C1 |
| InChI | InChI=1S/C22H33N3O5S/c1-29-18-12-19(30-2)20(31(23,27)28)11-17(18)22(26)24-16-9-10-25(13-16)21-14-5-3-6-15(21)8-4-7-14/h11-12,14-16,21H,3-10,13H2,1-2H3,(H,24,26)(H2,23,27,28)/t14?,15?,16-,21?/m0/s1 |
| InChIKey | VCIVQGTXUBMGBY-SAAHUIRJSA-N |
| XLogP | 2.12 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |