C22H32N2OS — CID 21477045
N-[1-(9-bicyclo[3.3.1]nonanyl)pyrrolidin-3-yl]-2-methoxy-4-methylbenzenecarbothioamide (PubChem CID 21477045) has the molecular formula C22H32N2OS and a molecular weight of 372.58 g/mol. Its IUPAC name is N-[1-(9-bicyclo[3.3.1]nonanyl)pyrrolidin-3-yl]-2-methoxy-4-methylbenzenecarbothioamide.
| Compound Name | N-[1-(9-bicyclo[3.3.1]nonanyl)pyrrolidin-3-yl]-2-methoxy-4-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 21477045 |
| Molecular Formula | C22H32N2OS |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | N-[1-(9-bicyclo[3.3.1]nonanyl)pyrrolidin-3-yl]-2-methoxy-4-methylbenzenecarbothioamide |
| SMILES | COc1cc(C)ccc1C(=S)NC1CCN(C2C3CCCC2CCC3)C1 |
| InChI | InChI=1S/C22H32N2OS/c1-15-9-10-19(20(13-15)25-2)22(26)23-18-11-12-24(14-18)21-16-5-3-6-17(21)8-4-7-16/h9-10,13,16-18,21H,3-8,11-12,14H2,1-2H3,(H,23,26) |
| InChIKey | GOMHZRDRHBTDSP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|