C28H38F2N6O6 — CID 160693193
4-amino-2-fluoro-5-methoxy-N-(1-methylpiperidin-4-yl)benzamide;2-fluoro-5-methoxy-N-(1-methylpiperidin-4-yl)-4-nitrobenzamide (PubChem CID 160693193) has the molecular formula C28H38F2N6O6 and a molecular weight of 592.64 g/mol. Its IUPAC name is 4-amino-2-fluoro-5-methoxy-N-(1-methylpiperidin-4-yl)benzamide;2-fluoro-5-methoxy-N-(1-methylpiperidin-4-yl)-4-nitrobenzamide.
| Compound Name | 4-amino-2-fluoro-5-methoxy-N-(1-methylpiperidin-4-yl)benzamide;2-fluoro-5-methoxy-N-(1-methylpiperidin-4-yl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 160693193 |
| Molecular Formula | C28H38F2N6O6 |
| Molecular Weight | 592.64 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | 4-amino-2-fluoro-5-methoxy-N-(1-methylpiperidin-4-yl)benzamide;2-fluoro-5-methoxy-N-(1-methylpiperidin-4-yl)-4-nitrobenzamide |
| SMILES | COc1cc(C(=O)NC2CCN(C)CC2)c(F)cc1N.COc1cc(C(=O)NC2CCN(C)CC2)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18FN3O4.C14H20FN3O2/c1-17-5-3-9(4-6-17)16-14(19)10-7-13(22-2)12(18(20)21)8-11(10)15;1-18-5-3-9(4-6-18)17-14(19)10-7-13(20-2)12(16)8-11(10)15/h7-9H,3-6H2,1-2H3,(H,16,19);7-9H,3-6,16H2,1-2H3,(H,17,19) |
| InChIKey | RPRBPCGAVQDPEP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 152.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.64 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|