C21H20FN7O2S — CID 88992691
1-ethyl-3-[3-[1-[(2-fluoro-3-methoxyphenyl)methyl]pyrazol-4-yl]pyrido[2,3-b]pyrazin-6-yl]-1-sulfanylurea (PubChem CID 88992691) has the molecular formula C21H20FN7O2S and a molecular weight of 453.50 g/mol. Its IUPAC name is 1-ethyl-3-[3-[1-[(2-fluoro-3-methoxyphenyl)methyl]pyrazol-4-yl]pyrido[2,3-b]pyrazin-6-yl]-1-sulfanylurea.
| Compound Name | 1-ethyl-3-[3-[1-[(2-fluoro-3-methoxyphenyl)methyl]pyrazol-4-yl]pyrido[2,3-b]pyrazin-6-yl]-1-sulfanylurea |
|---|---|
| PubChem CID | 88992691 |
| Molecular Formula | C21H20FN7O2S |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 1-ethyl-3-[3-[1-[(2-fluoro-3-methoxyphenyl)methyl]pyrazol-4-yl]pyrido[2,3-b]pyrazin-6-yl]-1-sulfanylurea |
| SMILES | CCN(S)C(=O)Nc1ccc2ncc(-c3cnn(Cc4cccc(OC)c4F)c3)nc2n1 |
| InChI | InChI=1S/C21H20FN7O2S/c1-3-29(32)21(30)27-18-8-7-15-20(26-18)25-16(10-23-15)14-9-24-28(12-14)11-13-5-4-6-17(31-2)19(13)22/h4-10,12,32H,3,11H2,1-2H3,(H,25,26,27,30) |
| InChIKey | YOISVMYOIAXRMH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|