C17H20N6S2 — CID 88993939
1-[3-(4-methyl-1,3-thiazol-2-yl)pyrido[2,3-b]pyrazin-6-yl]-3-pentylthiourea (PubChem CID 88993939) has the molecular formula C17H20N6S2 and a molecular weight of 372.52 g/mol. Its IUPAC name is 1-[3-(4-methyl-1,3-thiazol-2-yl)pyrido[2,3-b]pyrazin-6-yl]-3-pentylthiourea.
| Compound Name | 1-[3-(4-methyl-1,3-thiazol-2-yl)pyrido[2,3-b]pyrazin-6-yl]-3-pentylthiourea |
|---|---|
| PubChem CID | 88993939 |
| Molecular Formula | C17H20N6S2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 1-[3-(4-methyl-1,3-thiazol-2-yl)pyrido[2,3-b]pyrazin-6-yl]-3-pentylthiourea |
| SMILES | CCCCCNC(=S)Nc1ccc2ncc(-c3nc(C)cs3)nc2n1 |
| InChI | InChI=1S/C17H20N6S2/c1-3-4-5-8-18-17(24)23-14-7-6-12-15(22-14)21-13(9-19-12)16-20-11(2)10-25-16/h6-7,9-10H,3-5,8H2,1-2H3,(H2,18,21,22,23,24) |
| InChIKey | XGLCPMKXUFEGBE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|