C19H25N7S — CID 88993922
1-pentyl-3-[3-(1-propan-2-ylpyrazol-3-yl)pyrido[2,3-b]pyrazin-6-yl]thiourea (PubChem CID 88993922) has the molecular formula C19H25N7S and a molecular weight of 383.53 g/mol. Its IUPAC name is 1-pentyl-3-[3-(1-propan-2-ylpyrazol-3-yl)pyrido[2,3-b]pyrazin-6-yl]thiourea.
| Compound Name | 1-pentyl-3-[3-(1-propan-2-ylpyrazol-3-yl)pyrido[2,3-b]pyrazin-6-yl]thiourea |
|---|---|
| PubChem CID | 88993922 |
| Molecular Formula | C19H25N7S |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 1-pentyl-3-[3-(1-propan-2-ylpyrazol-3-yl)pyrido[2,3-b]pyrazin-6-yl]thiourea |
| SMILES | CCCCCNC(=S)Nc1ccc2ncc(-c3ccn(C(C)C)n3)nc2n1 |
| InChI | InChI=1S/C19H25N7S/c1-4-5-6-10-20-19(27)24-17-8-7-15-18(23-17)22-16(12-21-15)14-9-11-26(25-14)13(2)3/h7-9,11-13H,4-6,10H2,1-3H3,(H2,20,22,23,24,27) |
| InChIKey | XAAMTHSTTYBODT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|