C17H20N6S — CID 152976724
1-pentyl-3-[3-(3H-pyrrol-2-yl)pyrido[2,3-b]pyrazin-6-yl]thiourea (PubChem CID 152976724) has the molecular formula C17H20N6S and a molecular weight of 340.46 g/mol. Its IUPAC name is 1-pentyl-3-[3-(3H-pyrrol-2-yl)pyrido[2,3-b]pyrazin-6-yl]thiourea.
| Compound Name | 1-pentyl-3-[3-(3H-pyrrol-2-yl)pyrido[2,3-b]pyrazin-6-yl]thiourea |
|---|---|
| PubChem CID | 152976724 |
| Molecular Formula | C17H20N6S |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 1-pentyl-3-[3-(3H-pyrrol-2-yl)pyrido[2,3-b]pyrazin-6-yl]thiourea |
| SMILES | CCCCCNC(=S)Nc1ccc2ncc(C3=NC=CC3)nc2n1 |
| InChI | InChI=1S/C17H20N6S/c1-2-3-4-9-19-17(24)23-15-8-7-13-16(22-15)21-14(11-20-13)12-6-5-10-18-12/h5,7-8,10-11H,2-4,6,9H2,1H3,(H2,19,21,22,23,24) |
| InChIKey | UTOFJQYPQNJPIE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|