C20H23N5O3S — CID 88994190
methyl 2-methyl-5-[6-(pentylcarbamothioylamino)pyrido[2,3-b]pyrazin-3-yl]furan-3-carboxylate (PubChem CID 88994190) has the molecular formula C20H23N5O3S and a molecular weight of 413.50 g/mol. Its IUPAC name is methyl 2-methyl-5-[6-(pentylcarbamothioylamino)pyrido[2,3-b]pyrazin-3-yl]furan-3-carboxylate.
| Compound Name | methyl 2-methyl-5-[6-(pentylcarbamothioylamino)pyrido[2,3-b]pyrazin-3-yl]furan-3-carboxylate |
|---|---|
| PubChem CID | 88994190 |
| Molecular Formula | C20H23N5O3S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | methyl 2-methyl-5-[6-(pentylcarbamothioylamino)pyrido[2,3-b]pyrazin-3-yl]furan-3-carboxylate |
| SMILES | CCCCCNC(=S)Nc1ccc2ncc(-c3cc(C(=O)OC)c(C)o3)nc2n1 |
| InChI | InChI=1S/C20H23N5O3S/c1-4-5-6-9-21-20(29)25-17-8-7-14-18(24-17)23-15(11-22-14)16-10-13(12(2)28-16)19(26)27-3/h7-8,10-11H,4-6,9H2,1-3H3,(H2,21,23,24,25,29) |
| InChIKey | YSUKTWXNIKTQEY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|