C18H21N5S2 — CID 88994439
1-[3-(4-methylthiophen-2-yl)pyrido[2,3-b]pyrazin-6-yl]-3-pentylthiourea (PubChem CID 88994439) has the molecular formula C18H21N5S2 and a molecular weight of 371.54 g/mol. Its IUPAC name is 1-[3-(4-methylthiophen-2-yl)pyrido[2,3-b]pyrazin-6-yl]-3-pentylthiourea.
| Compound Name | 1-[3-(4-methylthiophen-2-yl)pyrido[2,3-b]pyrazin-6-yl]-3-pentylthiourea |
|---|---|
| PubChem CID | 88994439 |
| Molecular Formula | C18H21N5S2 |
| Molecular Weight | 371.54 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 1-[3-(4-methylthiophen-2-yl)pyrido[2,3-b]pyrazin-6-yl]-3-pentylthiourea |
| SMILES | CCCCCNC(=S)Nc1ccc2ncc(-c3cc(C)cs3)nc2n1 |
| InChI | InChI=1S/C18H21N5S2/c1-3-4-5-8-19-18(24)23-16-7-6-13-17(22-16)21-14(10-20-13)15-9-12(2)11-25-15/h6-7,9-11H,3-5,8H2,1-2H3,(H2,19,21,22,23,24) |
| InChIKey | GRTBFNFSKSHVAK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|