C13H11N5OS — CID 123875970
[3-(5-methylthiophen-2-yl)pyrido[2,3-b]pyrazin-6-yl]urea (PubChem CID 123875970) has the molecular formula C13H11N5OS and a molecular weight of 285.33 g/mol. Its IUPAC name is [3-(5-methylthiophen-2-yl)pyrido[2,3-b]pyrazin-6-yl]urea.
| Compound Name | [3-(5-methylthiophen-2-yl)pyrido[2,3-b]pyrazin-6-yl]urea |
|---|---|
| PubChem CID | 123875970 |
| Molecular Formula | C13H11N5OS |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | [3-(5-methylthiophen-2-yl)pyrido[2,3-b]pyrazin-6-yl]urea |
| SMILES | Cc1ccc(-c2cnc3ccc(NC(N)=O)nc3n2)s1 |
| InChI | InChI=1S/C13H11N5OS/c1-7-2-4-10(20-7)9-6-15-8-3-5-11(18-13(14)19)17-12(8)16-9/h2-6H,1H3,(H3,14,16,17,18,19) |
| InChIKey | FPQCRWDMESNKRE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |