C16H16N6OS2 — CID 88995559
1-cyclopentyl-1-sulfanyl-3-[3-(1,3-thiazol-5-yl)pyrido[2,3-b]pyrazin-6-yl]urea (PubChem CID 88995559) has the molecular formula C16H16N6OS2 and a molecular weight of 372.48 g/mol. Its IUPAC name is 1-cyclopentyl-1-sulfanyl-3-[3-(1,3-thiazol-5-yl)pyrido[2,3-b]pyrazin-6-yl]urea.
| Compound Name | 1-cyclopentyl-1-sulfanyl-3-[3-(1,3-thiazol-5-yl)pyrido[2,3-b]pyrazin-6-yl]urea |
|---|---|
| PubChem CID | 88995559 |
| Molecular Formula | C16H16N6OS2 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 1-cyclopentyl-1-sulfanyl-3-[3-(1,3-thiazol-5-yl)pyrido[2,3-b]pyrazin-6-yl]urea |
| SMILES | O=C(Nc1ccc2ncc(-c3cncs3)nc2n1)N(S)C1CCCC1 |
| InChI | InChI=1S/C16H16N6OS2/c23-16(22(24)10-3-1-2-4-10)21-14-6-5-11-15(20-14)19-12(7-18-11)13-8-17-9-25-13/h5-10,24H,1-4H2,(H,19,20,21,23) |
| InChIKey | PEFUDBXETRCJTD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|