C17H21N7S — CID 88993879
1-[3-(1-methylimidazol-4-yl)pyrido[2,3-b]pyrazin-6-yl]-3-pentylthiourea (PubChem CID 88993879) has the molecular formula C17H21N7S and a molecular weight of 355.47 g/mol. Its IUPAC name is 1-[3-(1-methylimidazol-4-yl)pyrido[2,3-b]pyrazin-6-yl]-3-pentylthiourea.
| Compound Name | 1-[3-(1-methylimidazol-4-yl)pyrido[2,3-b]pyrazin-6-yl]-3-pentylthiourea |
|---|---|
| PubChem CID | 88993879 |
| Molecular Formula | C17H21N7S |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 1-[3-(1-methylimidazol-4-yl)pyrido[2,3-b]pyrazin-6-yl]-3-pentylthiourea |
| SMILES | CCCCCNC(=S)Nc1ccc2ncc(-c3cn(C)cn3)nc2n1 |
| InChI | InChI=1S/C17H21N7S/c1-3-4-5-8-18-17(25)23-15-7-6-12-16(22-15)21-13(9-19-12)14-10-24(2)11-20-14/h6-7,9-11H,3-5,8H2,1-2H3,(H2,18,21,22,23,25) |
| InChIKey | BQEZLNFETCMVSU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|