C14H14N8S — CID 88994072
1-cyclopropyl-3-[3-(1-methyltriazol-4-yl)pyrido[2,3-b]pyrazin-6-yl]thiourea (PubChem CID 88994072) has the molecular formula C14H14N8S and a molecular weight of 326.39 g/mol. Its IUPAC name is 1-cyclopropyl-3-[3-(1-methyltriazol-4-yl)pyrido[2,3-b]pyrazin-6-yl]thiourea.
| Compound Name | 1-cyclopropyl-3-[3-(1-methyltriazol-4-yl)pyrido[2,3-b]pyrazin-6-yl]thiourea |
|---|---|
| PubChem CID | 88994072 |
| Molecular Formula | C14H14N8S |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 1-cyclopropyl-3-[3-(1-methyltriazol-4-yl)pyrido[2,3-b]pyrazin-6-yl]thiourea |
| SMILES | Cn1cc(-c2cnc3ccc(NC(=S)NC4CC4)nc3n2)nn1 |
| InChI | InChI=1S/C14H14N8S/c1-22-7-11(20-21-22)10-6-15-9-4-5-12(18-13(9)17-10)19-14(23)16-8-2-3-8/h4-8H,2-3H2,1H3,(H2,16,17,18,19,23) |
| InChIKey | CFLNAGJOPBBOFB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|