C21H27N5O4 — CID 88994416
1-[3-[5-(ethoxymethoxymethyl)furan-2-yl]pyrido[2,3-b]pyrazin-6-yl]-3-pentylurea (PubChem CID 88994416) has the molecular formula C21H27N5O4 and a molecular weight of 413.48 g/mol. Its IUPAC name is 1-[3-[5-(ethoxymethoxymethyl)furan-2-yl]pyrido[2,3-b]pyrazin-6-yl]-3-pentylurea.
| Compound Name | 1-[3-[5-(ethoxymethoxymethyl)furan-2-yl]pyrido[2,3-b]pyrazin-6-yl]-3-pentylurea |
|---|---|
| PubChem CID | 88994416 |
| Molecular Formula | C21H27N5O4 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 1-[3-[5-(ethoxymethoxymethyl)furan-2-yl]pyrido[2,3-b]pyrazin-6-yl]-3-pentylurea |
| SMILES | CCCCCNC(=O)Nc1ccc2ncc(-c3ccc(COCOCC)o3)nc2n1 |
| InChI | InChI=1S/C21H27N5O4/c1-3-5-6-11-22-21(27)26-19-10-8-16-20(25-19)24-17(12-23-16)18-9-7-15(30-18)13-29-14-28-4-2/h7-10,12H,3-6,11,13-14H2,1-2H3,(H2,22,24,25,26,27) |
| InChIKey | PKUDSYIGEGVRAK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 111.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|