C20H15ClF3N3OS — CID 84820048
1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-3-(2-phenoxyphenyl)thiourea (PubChem CID 84820048) has the molecular formula C20H15ClF3N3OS and a molecular weight of 437.87 g/mol. Its IUPAC name is 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-3-(2-phenoxyphenyl)thiourea.
| Compound Name | 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-3-(2-phenoxyphenyl)thiourea |
|---|---|
| PubChem CID | 84820048 |
| Molecular Formula | C20H15ClF3N3OS |
| Molecular Weight | 437.87 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-3-(2-phenoxyphenyl)thiourea |
| SMILES | FC(F)(F)c1cnc(CNC(=S)Nc2ccccc2Oc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C20H15ClF3N3OS/c21-15-10-13(20(22,23)24)11-25-17(15)12-26-19(29)27-16-8-4-5-9-18(16)28-14-6-2-1-3-7-14/h1-11H,12H2,(H2,26,27,29) |
| InChIKey | RIOSDMHZHANTRU-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.87 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_urea_E(7)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|