C22H19F3N2O2 — CID 74225420
1-(2-phenoxyphenyl)-3-[2-[3-(trifluoromethyl)phenyl]ethyl]urea (PubChem CID 74225420) has the molecular formula C22H19F3N2O2 and a molecular weight of 400.40 g/mol. Its IUPAC name is 1-(2-phenoxyphenyl)-3-[2-[3-(trifluoromethyl)phenyl]ethyl]urea.
| Compound Name | 1-(2-phenoxyphenyl)-3-[2-[3-(trifluoromethyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 74225420 |
| Molecular Formula | C22H19F3N2O2 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 1-(2-phenoxyphenyl)-3-[2-[3-(trifluoromethyl)phenyl]ethyl]urea |
| SMILES | O=C(NCCc1cccc(C(F)(F)F)c1)Nc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C22H19F3N2O2/c23-22(24,25)17-8-6-7-16(15-17)13-14-26-21(28)27-19-11-4-5-12-20(19)29-18-9-2-1-3-10-18/h1-12,15H,13-14H2,(H2,26,27,28) |
| InChIKey | BKDKBSAEERRUDF-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |