C18H17F3N2O — CID 121264659
1-[(E)-2-phenylethenyl]-3-[2-[3-(trifluoromethyl)phenyl]ethyl]urea (PubChem CID 121264659) has the molecular formula C18H17F3N2O and a molecular weight of 334.34 g/mol. Its IUPAC name is 1-[(E)-2-phenylethenyl]-3-[2-[3-(trifluoromethyl)phenyl]ethyl]urea.
| Compound Name | 1-[(E)-2-phenylethenyl]-3-[2-[3-(trifluoromethyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 121264659 |
| Molecular Formula | C18H17F3N2O |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 1-[(E)-2-phenylethenyl]-3-[2-[3-(trifluoromethyl)phenyl]ethyl]urea |
| SMILES | O=C(N/C=C/c1ccccc1)NCCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H17F3N2O/c19-18(20,21)16-8-4-7-15(13-16)10-12-23-17(24)22-11-9-14-5-2-1-3-6-14/h1-9,11,13H,10,12H2,(H2,22,23,24)/b11-9+ |
| InChIKey | OSLIWULKPSAFFR-PKNBQFBNSA-N |
| XLogP | 4.22 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |