C19H21BrN2O — CID 108907152
1-[(E)-2-(3-bromophenyl)ethenyl]-3-(4-phenylbutyl)urea (PubChem CID 108907152) has the molecular formula C19H21BrN2O and a molecular weight of 373.29 g/mol. Its IUPAC name is 1-[(E)-2-(3-bromophenyl)ethenyl]-3-(4-phenylbutyl)urea.
| Compound Name | 1-[(E)-2-(3-bromophenyl)ethenyl]-3-(4-phenylbutyl)urea |
|---|---|
| PubChem CID | 108907152 |
| Molecular Formula | C19H21BrN2O |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 1-[(E)-2-(3-bromophenyl)ethenyl]-3-(4-phenylbutyl)urea |
| SMILES | O=C(N/C=C/c1cccc(Br)c1)NCCCCc1ccccc1 |
| InChI | InChI=1S/C19H21BrN2O/c20-18-11-6-10-17(15-18)12-14-22-19(23)21-13-5-4-9-16-7-2-1-3-8-16/h1-3,6-8,10-12,14-15H,4-5,9,13H2,(H2,21,22,23)/b14-12+ |
| InChIKey | OFUSNGDYCIJYIH-WYMLVPIESA-N |
| XLogP | 4.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|