C16H14Br2N2O — CID 108907130
1-[(E)-2-(3-bromophenyl)ethenyl]-3-[(4-bromophenyl)methyl]urea (PubChem CID 108907130) has the molecular formula C16H14Br2N2O and a molecular weight of 410.11 g/mol. Its IUPAC name is 1-[(E)-2-(3-bromophenyl)ethenyl]-3-[(4-bromophenyl)methyl]urea.
| Compound Name | 1-[(E)-2-(3-bromophenyl)ethenyl]-3-[(4-bromophenyl)methyl]urea |
|---|---|
| PubChem CID | 108907130 |
| Molecular Formula | C16H14Br2N2O |
| Molecular Weight | 410.11 g/mol |
| Exact Mass | 407.95 |
| IUPAC Name | 1-[(E)-2-(3-bromophenyl)ethenyl]-3-[(4-bromophenyl)methyl]urea |
| SMILES | O=C(N/C=C/c1cccc(Br)c1)NCc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H14Br2N2O/c17-14-6-4-13(5-7-14)11-20-16(21)19-9-8-12-2-1-3-15(18)10-12/h1-10H,11H2,(H2,19,20,21)/b9-8+ |
| InChIKey | IIUUSIXALKWNSH-CMDGGOBGSA-N |
| XLogP | 4.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.11 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |