C18H14ClF3N2O5 — CID 168566431
dimethyl (E)-2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]anilino]but-2-enedioate (PubChem CID 168566431) has the molecular formula C18H14ClF3N2O5 and a molecular weight of 430.77 g/mol. Its IUPAC name is dimethyl (E)-2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168566431 |
| Molecular Formula | C18H14ClF3N2O5 |
| Molecular Weight | 430.77 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | dimethyl (E)-2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccccc1Oc1ncc(C(F)(F)F)cc1Cl)C(=O)OC |
| InChI | InChI=1S/C18H14ClF3N2O5/c1-27-15(25)8-13(17(26)28-2)24-12-5-3-4-6-14(12)29-16-11(19)7-10(9-23-16)18(20,21)22/h3-9,24H,1-2H3/b13-8+ |
| InChIKey | GQJOSGOHCYUILR-MDWZMJQESA-N |
| XLogP | 4.19 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.77 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|