C14H12F5NO5 — CID 168567432
dimethyl (E)-2-[2-(difluoromethoxy)-5-(trifluoromethyl)anilino]but-2-enedioate (PubChem CID 168567432) has the molecular formula C14H12F5NO5 and a molecular weight of 369.24 g/mol. Its IUPAC name is dimethyl (E)-2-[2-(difluoromethoxy)-5-(trifluoromethyl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[2-(difluoromethoxy)-5-(trifluoromethyl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168567432 |
| Molecular Formula | C14H12F5NO5 |
| Molecular Weight | 369.24 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | dimethyl (E)-2-[2-(difluoromethoxy)-5-(trifluoromethyl)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cc(C(F)(F)F)ccc1OC(F)F)C(=O)OC |
| InChI | InChI=1S/C14H12F5NO5/c1-23-11(21)6-9(12(22)24-2)20-8-5-7(14(17,18)19)3-4-10(8)25-13(15)16/h3-6,13,20H,1-2H3/b9-6+ |
| InChIKey | GXAOWNBWFVMMOL-RMKNXTFCSA-N |
| XLogP | 2.95 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|