C19H16F3NO7S — CID 168567833
dimethyl (E)-2-[2-(2-methoxycarbonylthiophen-3-yl)oxy-5-(trifluoromethyl)anilino]but-2-enedioate (PubChem CID 168567833) has the molecular formula C19H16F3NO7S and a molecular weight of 459.40 g/mol. Its IUPAC name is dimethyl (E)-2-[2-(2-methoxycarbonylthiophen-3-yl)oxy-5-(trifluoromethyl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[2-(2-methoxycarbonylthiophen-3-yl)oxy-5-(trifluoromethyl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168567833 |
| Molecular Formula | C19H16F3NO7S |
| Molecular Weight | 459.40 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | dimethyl (E)-2-[2-(2-methoxycarbonylthiophen-3-yl)oxy-5-(trifluoromethyl)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cc(C(F)(F)F)ccc1Oc1ccsc1C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C19H16F3NO7S/c1-27-15(24)9-12(17(25)28-2)23-11-8-10(19(20,21)22)4-5-13(11)30-14-6-7-31-16(14)18(26)29-3/h4-9,23H,1-3H3/b12-9+ |
| InChIKey | ARXHEUBPCJHKJO-FMIVXFBMSA-N |
| XLogP | 3.99 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|