C14H9ClF3NO4S — CID 20623583
3-[2-[(2-chloroacetyl)amino]-4-(trifluoromethyl)phenoxy]thiophene-2-carboxylic acid (PubChem CID 20623583) has the molecular formula C14H9ClF3NO4S and a molecular weight of 379.74 g/mol. Its IUPAC name is 3-[2-[(2-chloroacetyl)amino]-4-(trifluoromethyl)phenoxy]thiophene-2-carboxylic acid.
| Compound Name | 3-[2-[(2-chloroacetyl)amino]-4-(trifluoromethyl)phenoxy]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 20623583 |
| Molecular Formula | C14H9ClF3NO4S |
| Molecular Weight | 379.74 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | 3-[2-[(2-chloroacetyl)amino]-4-(trifluoromethyl)phenoxy]thiophene-2-carboxylic acid |
| SMILES | O=C(CCl)Nc1cc(C(F)(F)F)ccc1Oc1ccsc1C(=O)O |
| InChI | InChI=1S/C14H9ClF3NO4S/c15-6-11(20)19-8-5-7(14(16,17)18)1-2-9(8)23-10-3-4-24-12(10)13(21)22/h1-5H,6H2,(H,19,20)(H,21,22) |
| InChIKey | FGWHSMCNVYESDR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.74 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|