C17H13ClF3NO3 — CID 86231173
2-chloro-N-[4-methoxy-2-[4-(trifluoromethyl)benzoyl]phenyl]acetamide (PubChem CID 86231173) has the molecular formula C17H13ClF3NO3 and a molecular weight of 371.74 g/mol. Its IUPAC name is 2-chloro-N-[4-methoxy-2-[4-(trifluoromethyl)benzoyl]phenyl]acetamide.
| Compound Name | 2-chloro-N-[4-methoxy-2-[4-(trifluoromethyl)benzoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 86231173 |
| Molecular Formula | C17H13ClF3NO3 |
| Molecular Weight | 371.74 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 2-chloro-N-[4-methoxy-2-[4-(trifluoromethyl)benzoyl]phenyl]acetamide |
| SMILES | COc1ccc(NC(=O)CCl)c(C(=O)c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C17H13ClF3NO3/c1-25-12-6-7-14(22-15(23)9-18)13(8-12)16(24)10-2-4-11(5-3-10)17(19,20)21/h2-8H,9H2,1H3,(H,22,23) |
| InChIKey | WPRMROYNBMMNSD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.74 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|