C16H11ClF3NO4 — CID 174347872
[2-(4-chloro-3-methoxybenzoyl)-4-(trifluoromethyl)phenyl]carbamic acid (PubChem CID 174347872) has the molecular formula C16H11ClF3NO4 and a molecular weight of 373.71 g/mol. Its IUPAC name is [2-(4-chloro-3-methoxybenzoyl)-4-(trifluoromethyl)phenyl]carbamic acid.
| Compound Name | [2-(4-chloro-3-methoxybenzoyl)-4-(trifluoromethyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 174347872 |
| Molecular Formula | C16H11ClF3NO4 |
| Molecular Weight | 373.71 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | [2-(4-chloro-3-methoxybenzoyl)-4-(trifluoromethyl)phenyl]carbamic acid |
| SMILES | COc1cc(C(=O)c2cc(C(F)(F)F)ccc2NC(=O)O)ccc1Cl |
| InChI | InChI=1S/C16H11ClF3NO4/c1-25-13-6-8(2-4-11(13)17)14(22)10-7-9(16(18,19)20)3-5-12(10)21-15(23)24/h2-7,21H,1H3,(H,23,24) |
| InChIKey | CHDYOKDWAZKTOK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.71 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |