C9H7ClF2O3 — CID 79712096
2-(4-chloro-3-methoxyphenyl)-2,2-difluoroacetic acid (PubChem CID 79712096) has the molecular formula C9H7ClF2O3 and a molecular weight of 236.60 g/mol. Its IUPAC name is 2-(4-chloro-3-methoxyphenyl)-2,2-difluoroacetic acid.
| Compound Name | 2-(4-chloro-3-methoxyphenyl)-2,2-difluoroacetic acid |
|---|---|
| PubChem CID | 79712096 |
| Molecular Formula | C9H7ClF2O3 |
| Molecular Weight | 236.60 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | 2-(4-chloro-3-methoxyphenyl)-2,2-difluoroacetic acid |
| SMILES | COc1cc(C(F)(F)C(=O)O)ccc1Cl |
| InChI | InChI=1S/C9H7ClF2O3/c1-15-7-4-5(2-3-6(7)10)9(11,12)8(13)14/h2-4H,1H3,(H,13,14) |
| InChIKey | ZHZJLBVTDJDGQU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.60 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |