C10H9ClF2O2 — CID 142387180
3-(4-chloro-3-methoxyphenyl)-3,3-difluoropropanal (PubChem CID 142387180) has the molecular formula C10H9ClF2O2 and a molecular weight of 234.63 g/mol. Its IUPAC name is 3-(4-chloro-3-methoxyphenyl)-3,3-difluoropropanal.
| Compound Name | 3-(4-chloro-3-methoxyphenyl)-3,3-difluoropropanal |
|---|---|
| PubChem CID | 142387180 |
| Molecular Formula | C10H9ClF2O2 |
| Molecular Weight | 234.63 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 3-(4-chloro-3-methoxyphenyl)-3,3-difluoropropanal |
| SMILES | COc1cc(C(F)(F)CC=O)ccc1Cl |
| InChI | InChI=1S/C10H9ClF2O2/c1-15-9-6-7(2-3-8(9)11)10(12,13)4-5-14/h2-3,5-6H,4H2,1H3 |
| InChIKey | IIQRZZKRZBKRRI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.63 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|