C12H14F2O — CID 162555196
4-(1,1-difluorobut-3-enyl)-2-methoxy-1-methylbenzene (PubChem CID 162555196) has the molecular formula C12H14F2O and a molecular weight of 212.24 g/mol. Its IUPAC name is 4-(1,1-difluorobut-3-enyl)-2-methoxy-1-methylbenzene.
| Compound Name | 4-(1,1-difluorobut-3-enyl)-2-methoxy-1-methylbenzene |
|---|---|
| PubChem CID | 162555196 |
| Molecular Formula | C12H14F2O |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 4-(1,1-difluorobut-3-enyl)-2-methoxy-1-methylbenzene |
| SMILES | C=CCC(F)(F)c1ccc(C)c(OC)c1 |
| InChI | InChI=1S/C12H14F2O/c1-4-7-12(13,14)10-6-5-9(2)11(8-10)15-3/h4-6,8H,1,7H2,2-3H3 |
| InChIKey | KBFPVMCOORVIOS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|