C16H20F2N2O3 — CID 166416014
N-[2-[[2,2-difluoro-2-(3-methoxy-4-methylphenyl)ethyl]amino]-2-oxoethyl]-N-methylprop-2-enamide (PubChem CID 166416014) has the molecular formula C16H20F2N2O3 and a molecular weight of 326.34 g/mol. Its IUPAC name is N-[2-[[2,2-difluoro-2-(3-methoxy-4-methylphenyl)ethyl]amino]-2-oxoethyl]-N-methylprop-2-enamide.
| Compound Name | N-[2-[[2,2-difluoro-2-(3-methoxy-4-methylphenyl)ethyl]amino]-2-oxoethyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 166416014 |
| Molecular Formula | C16H20F2N2O3 |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-[2-[[2,2-difluoro-2-(3-methoxy-4-methylphenyl)ethyl]amino]-2-oxoethyl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)CC(=O)NCC(F)(F)c1ccc(C)c(OC)c1 |
| InChI | InChI=1S/C16H20F2N2O3/c1-5-15(22)20(3)9-14(21)19-10-16(17,18)12-7-6-11(2)13(8-12)23-4/h5-8H,1,9-10H2,2-4H3,(H,19,21) |
| InChIKey | VINMTQUELIZQEZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|